cas: 191340-90-6 — see every product listed under this CAS number, including other names
2-Chloro-3-(trifluoromethyl)pyrazine 95% (CAS 191340-90-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A436683-100mg |
| cas | 191340-90-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 759.75 Pln | |
| Ambeed | 5g | 2289.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A436683 |
2-chloro-3-(trifluoromethyl)pyrazine (CAS 191340-90-6) is a chemical compound with the molecular formula C5H2ClF3N2 and a molecular weight of 182.53 g/mol. IUPAC name: 2-chloro-3-(trifluoromethyl)pyrazine. InChIKey: FXNHOYJCHUHVNX-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF3N2 |
|---|---|
| Molecular weight | 182.53 g/mol |
| IUPAC name | 2-chloro-3-(trifluoromethyl)pyrazine |
| InChIKey | FXNHOYJCHUHVNX-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)