CAS 2693-57-4 appears in our catalog under these names: 4-Amino-3-chloro-2,5,6-trifluoropyridine, 4-Amino-3-chloro-2,5,6-trifluoropyridine, 95%, 3-Chloro-2,5,6-trifluoropyridin-4-amine, 98%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg, 10000mg, 1g, 5g, 25g.
3-chloro-2,5,6-trifluoropyridin-4-amine (CAS 2693-57-4) is a chemical compound with the molecular formula C5H2ClF3N2 and a molecular weight of 182.53 g/mol. IUPAC name: 3-chloro-2,5,6-trifluoropyridin-4-amine. InChIKey: IJGMBUFHHBUVNG-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF3N2 |
|---|---|
| Molecular weight | 182.53 g/mol |
| IUPAC name | 3-chloro-2,5,6-trifluoropyridin-4-amine |
| InChIKey | IJGMBUFHHBUVNG-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)F)F)F)N |
Computed by PubChem (NCBI)