2-Chloro-3-ethoxy-6-fluorophenylboronic acid, 97%
cas: 957120-93-3 — see every product listed under this CAS number, including other names
2-Chloro-3-ethoxy-6-fluorophenylboronic acid, 97% (CAS 957120-93-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A168548-250mg |
| cas | 957120-93-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 370.38 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 386.00 Pln | |
| BLDpharm | 250mg | 131.09 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 358.79 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 10g | 685.19 Pln | |
| Fluorochem | 25g | 1622.36 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2-chloro-3-ethoxy-6-fluorophenyl)boronic acid (CAS 957120-93-3) is a chemical compound with the molecular formula C8H9BClFO3 and a molecular weight of 218.42 g/mol. IUPAC name: (2-chloro-3-ethoxy-6-fluorophenyl)boronic acid. InChIKey: OYOREJXDXHCMPQ-UHFFFAOYSA-N.
| Molecular formula | C8H9BClFO3 |
|---|---|
| Molecular weight | 218.42 g/mol |
| IUPAC name | (2-chloro-3-ethoxy-6-fluorophenyl)boronic acid |
| InChIKey | OYOREJXDXHCMPQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)OCC)F)(O)O |
Computed by PubChem (NCBI)