cas: 1073312-28-3 — see every product listed under this CAS number, including other names
2-Chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97% (CAS 1073312-28-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F243621-250MG |
| cas | 1073312-28-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 5g | 2174.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1073312-28-3) is a chemical compound with the molecular formula C11H14BClFNO2 and a molecular weight of 257.50 g/mol. IUPAC name: 2-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: QTSFEDRDXGFGKR-UHFFFAOYSA-N.
| Molecular formula | C11H14BClFNO2 |
|---|---|
| Molecular weight | 257.50 g/mol |
| IUPAC name | 2-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | QTSFEDRDXGFGKR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)Cl)F |
Computed by PubChem (NCBI)