CAS 2121513-37-7 is the registry number for 4-Chloro-5-fluoropyridine-3-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2121513-37-7) is a chemical compound with the molecular formula C11H14BClFNO2 and a molecular weight of 257.50 g/mol. IUPAC name: 4-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: OTSFMNKAPYKDQM-UHFFFAOYSA-N.
| Molecular formula | C11H14BClFNO2 |
|---|---|
| Molecular weight | 257.50 g/mol |
| IUPAC name | 4-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | OTSFMNKAPYKDQM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CC(=C2Cl)F |
Computed by PubChem (NCBI)