cas: 7597-22-0 — see every product listed under this CAS number, including other names
2-Chloro-4,6-dimorpholino-1,3,5-triazine 95% (CAS 7597-22-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A723545-250mg |
| cas | 7597-22-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 809.81 Pln | |
| Ambeed | 10g | 1510.69 Pln | |
| Ambeed | 25g | 3196.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A723545 |
4-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)morpholine (CAS 7597-22-0) is a chemical compound with the molecular formula C11H16ClN5O2 and a molecular weight of 285.73 g/mol. IUPAC name: 4-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)morpholine. InChIKey: WYCCBNGHFYBVOM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN5O2 |
|---|---|
| Molecular weight | 285.73 g/mol |
| IUPAC name | 4-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)morpholine |
| InChIKey | WYCCBNGHFYBVOM-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC(=NC(=N2)Cl)N3CCOCC3 |
Computed by PubChem (NCBI)