cas: 7597-22-0 — see every product listed under this CAS number, including other names
2-chloro-4,6-di-4-morpholinyl-1,3,5-triazine, 95%, 95% (CAS 7597-22-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11479C-250mg |
| cas | 7597-22-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 640.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)morpholine (CAS 7597-22-0) is a chemical compound with the molecular formula C11H16ClN5O2 and a molecular weight of 285.73 g/mol. IUPAC name: 4-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)morpholine. InChIKey: WYCCBNGHFYBVOM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN5O2 |
|---|---|
| Molecular weight | 285.73 g/mol |
| IUPAC name | 4-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)morpholine |
| InChIKey | WYCCBNGHFYBVOM-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC(=NC(=N2)Cl)N3CCOCC3 |
Computed by PubChem (NCBI)