2-Chloro-4,6-diphenyl-1,3,5-triazine, 98%
cas: 3842-55-5 — see every product listed under this CAS number, including other names
2-Chloro-4,6-diphenyl-1,3,5-triazine, 98% (CAS 3842-55-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A413484-1g |
| cas | 3842-55-5 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 159.00 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 704.12 Pln | |
| Ambeed | 500g | 2612.06 Pln | |
| Ambeed | 1kg | 4386.50 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 10g | 231.05 Pln | |
| BLDpharm | 25g | 292.14 Pln | |
| BLDpharm | 100g | 753.09 Pln | |
| BLDpharm | 500g | 2807.92 Pln | |
| BLDpharm | 1kg | 4723.92 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-4,6-diphenyl-1,3,5-triazine (CAS 3842-55-5) is a chemical compound with the molecular formula C15H10ClN3 and a molecular weight of 267.71 g/mol. IUPAC name: 2-chloro-4,6-diphenyl-1,3,5-triazine. InChIKey: DDGPPAMADXTGTN-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN3 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 2-chloro-4,6-diphenyl-1,3,5-triazine |
| InChIKey | DDGPPAMADXTGTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-4,6-diphenyl-1,3,5-triazine, 1,3,5-Triazine, 2-chloro-4,6-diphenyl-, Diphenyl chloro-s-triazine, 4,6-diphenyl-2-chloro-s-triazine, CITPTA, 2-chloro-4,6-bisphenyl-1,3,5-triazine, 2-chloro-[4,6-bisphenyl]-1,3,5-triazine, 1,5-Triaz, 2-chloro4,6-diphenyl-s-triazine, S-Triazine, 2-chloro-4,6-diphenyl-