CAS 942206-13-5 is the registry number for 6''-Chloro-3,2':5',3''-terpyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg.
2-chloro-5-(6-pyridin-3-yl-3-pyridinyl)pyridine (CAS 942206-13-5) is a chemical compound with the molecular formula C15H10ClN3 and a molecular weight of 267.71 g/mol. IUPAC name: 2-chloro-5-(6-pyridin-3-yl-3-pyridinyl)pyridine. InChIKey: HFAGORVNAKFNGR-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN3 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 2-chloro-5-(6-pyridin-3-yl-3-pyridinyl)pyridine |
| InChIKey | HFAGORVNAKFNGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC=C(C=C2)C3=CN=C(C=C3)Cl |
Computed by PubChem (NCBI)