cas: 52476-66-1 — see every product listed under this CAS number, including other names
2-Chloro-4-(3,5-dimethyl-1H-pyrazol-1-yl)pyrimidine 95% (CAS 52476-66-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1013461-100mg |
| cas | 52476-66-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 871.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1013461 |
2-chloro-4-(3,5-dimethylpyrazol-1-yl)pyrimidine (CAS 52476-66-1) is a chemical compound with the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. IUPAC name: 2-chloro-4-(3,5-dimethylpyrazol-1-yl)pyrimidine. InChIKey: ZAEUNAXJMQKCCG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4 |
|---|---|
| Molecular weight | 208.65 g/mol |
| IUPAC name | 2-chloro-4-(3,5-dimethylpyrazol-1-yl)pyrimidine |
| InChIKey | ZAEUNAXJMQKCCG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=NC(=NC=C2)Cl)C |
Computed by PubChem (NCBI)