CAS 832739-72-7 appears in our catalog under these names: 1-(3-Chlorobenzyl)-1h-1,2,4-triazol-3-amine, 95%, 1-(3-Chlorobenzyl)-1H-1,2,4-triazol-3-amine, 98%, 1-(3-Chlorobenzyl)-1H-1,2,4-triazol-3-amine, 98%, 98%, 1-(3-Chloro-benzyl)-1 H -[1,2,4]triazol-3-ylamine, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-[(3-chlorophenyl)methyl]-1,2,4-triazol-3-amine (CAS 832739-72-7) is a chemical compound with the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. IUPAC name: 1-[(3-chlorophenyl)methyl]-1,2,4-triazol-3-amine. InChIKey: CNQNEIWBVLGIEA-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4 |
|---|---|
| Molecular weight | 208.65 g/mol |
| IUPAC name | 1-[(3-chlorophenyl)methyl]-1,2,4-triazol-3-amine |
| InChIKey | CNQNEIWBVLGIEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CN2C=NC(=N2)N |
Computed by PubChem (NCBI)