cas: 749256-90-4 — see every product listed under this CAS number, including other names
2-Chloro-4-methyl-6-(trifluoromethyl)pyridine, 97%, 97% (CAS 749256-90-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119OKF-100mg |
| cas | 749256-90-4 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 1197.20 Pln | |
| Chemat | 5g | 4029.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-methyl-6-(trifluoromethyl)pyridine (CAS 749256-90-4) is a chemical compound with the molecular formula C7H5ClF3N and a molecular weight of 195.57 g/mol. IUPAC name: 2-chloro-4-methyl-6-(trifluoromethyl)pyridine. InChIKey: KAYVWTDOIYYSDL-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3N |
|---|---|
| Molecular weight | 195.57 g/mol |
| IUPAC name | 2-chloro-4-methyl-6-(trifluoromethyl)pyridine |
| InChIKey | KAYVWTDOIYYSDL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)