cas: 1426804-80-9 — see every product listed under this CAS number, including other names
2-Chloro-4-nitrophenylboronic acid, pinacol ester, 95%, 95% (CAS 1426804-80-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WU3-50mg |
| cas | 1426804-80-9 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 813.20 Pln | |
| Chemat | 100mg | 1182.80 Pln | |
| Chemat | 250mg | 1658.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(2-chloro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1426804-80-9) is a chemical compound with the molecular formula C12H15BClNO4 and a molecular weight of 283.52 g/mol. IUPAC name: 2-(2-chloro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: AYPQIFIELRRUTA-UHFFFAOYSA-N.
| Molecular formula | C12H15BClNO4 |
|---|---|
| Molecular weight | 283.52 g/mol |
| IUPAC name | 2-(2-chloro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | AYPQIFIELRRUTA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)