CAS 1426804-80-9 appears in our catalog under these names: 2-Chloro-4-nitrophenylboronic acid, pinacol ester, 98%, 2-(2-Chloro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(2-Chloro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%, 2-Chloro-4-nitrophenylboronic acid, pinacol ester, 95%, 95%, 2-CHLORO-4-NITROPHENYLBORONIC ACID, PINACOL ESTER, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 50mg.
2-(2-chloro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1426804-80-9) is a chemical compound with the molecular formula C12H15BClNO4 and a molecular weight of 283.52 g/mol. IUPAC name: 2-(2-chloro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: AYPQIFIELRRUTA-UHFFFAOYSA-N.
| Molecular formula | C12H15BClNO4 |
|---|---|
| Molecular weight | 283.52 g/mol |
| IUPAC name | 2-(2-chloro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | AYPQIFIELRRUTA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)