cas: 14432-16-7 — see every product listed under this CAS number, including other names
2-Chloro-4-nitropyridine N-oxide (CAS 14432-16-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225475-1G |
| cas | 14432-16-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 268.67 Pln | |
| Fluorochem | 25g | 721.64 Pln |
| delivery time | 3-4 weeks |
|---|
2-chloro-4-nitro-1-oxidopyridin-1-ium (CAS 14432-16-7) is a chemical compound with the molecular formula C5H3ClN2O3 and a molecular weight of 174.54 g/mol. IUPAC name: 2-chloro-4-nitro-1-oxidopyridin-1-ium. InChIKey: YSTCMHHKDOVZDA-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O3 |
|---|---|
| Molecular weight | 174.54 g/mol |
| IUPAC name | 2-chloro-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | YSTCMHHKDOVZDA-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=C(C=C1[N+](=O)[O-])Cl)[O-] |
Computed by PubChem (NCBI)