cas: 14432-16-7 — see every product listed under this CAS number, including other names
2–Chloro–4–nitropyridine N–oxide (CAS 14432-16-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 50g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD06423-1g |
| cas | 14432-16-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 517.47 Pln | |
| GLPBio | 25g | 999.56 Pln | |
| GLPBio | 50g | 1350.60 Pln | |
| GLPBio | 5g | 559.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-4-nitro-1-oxidopyridin-1-ium (CAS 14432-16-7) is a chemical compound with the molecular formula C5H3ClN2O3 and a molecular weight of 174.54 g/mol. IUPAC name: 2-chloro-4-nitro-1-oxidopyridin-1-ium. InChIKey: YSTCMHHKDOVZDA-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O3 |
|---|---|
| Molecular weight | 174.54 g/mol |
| IUPAC name | 2-chloro-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | YSTCMHHKDOVZDA-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=C(C=C1[N+](=O)[O-])Cl)[O-] |
Computed by PubChem (NCBI)