cas: 163563-64-2 — see every product listed under this CAS number, including other names
2-Chloro-4-phenylnicotinonitrile, 98% (CAS 163563-64-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A279399-1g |
| cas | 163563-64-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 356.44 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 716.43 Pln | |
| Fluorochem | 10g | 1127.75 Pln | |
| Fluorochem | 25g | 2143.01 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-4-phenylpyridine-3-carbonitrile (CAS 163563-64-2) is a chemical compound with the molecular formula C12H7ClN2 and a molecular weight of 214.65 g/mol. IUPAC name: 2-chloro-4-phenylpyridine-3-carbonitrile. InChIKey: GYTQTBOCDGGMRW-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 2-chloro-4-phenylpyridine-3-carbonitrile |
| InChIKey | GYTQTBOCDGGMRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=NC=C2)Cl)C#N |
Computed by PubChem (NCBI)