CAS 1355247-94-7 is the registry number for 3-(4-Chlorophenyl)pyridine-2-carbonitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(4-chlorophenyl)pyridine-2-carbonitrile (CAS 1355247-94-7) is a chemical compound with the molecular formula C12H7ClN2 and a molecular weight of 214.65 g/mol. IUPAC name: 3-(4-chlorophenyl)pyridine-2-carbonitrile. InChIKey: GVWASMAZWFRZLO-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 3-(4-chlorophenyl)pyridine-2-carbonitrile |
| InChIKey | GVWASMAZWFRZLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C#N)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)