2-Chloro-4-phenylquinoline, 97%
cas: 5855-56-1 — see every product listed under this CAS number, including other names
2-Chloro-4-phenylquinoline, 97% (CAS 5855-56-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A679986-100mg |
| cas | 5855-56-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1633.06 Pln | |
| Ambeed | 5g | 5115.19 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1590.80 Pln | |
| Fluorochem | 100mg | 716.43 Pln | |
| Fluorochem | 250mg | 1164.19 Pln | |
| Fluorochem | 1g | 2960.43 Pln | |
| BLDpharm | 100mg | 514.29 Pln | |
| BLDpharm | 250mg | 692.00 Pln | |
| BLDpharm | 1g | 1752.74 Pln | |
| BLDpharm | 5g | 5506.97 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-4-phenylquinoline (CAS 5855-56-1) is a chemical compound with the molecular formula C15H10ClN and a molecular weight of 239.70 g/mol. IUPAC name: 2-chloro-4-phenylquinoline. InChIKey: OBMBUODDCOAJQP-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 2-chloro-4-phenylquinoline |
| InChIKey | OBMBUODDCOAJQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC3=CC=CC=C32)Cl |
Computed by PubChem (NCBI)