Products 24698-70-2
CAS 24698-70-2 is the registry number for 2-(4-Chloro)phenylquinoline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
2-(4-chlorophenyl)quinoline (CAS 24698-70-2) is a chemical compound with the molecular formula C15H10ClN and a molecular weight of 239.70 g/mol. IUPAC name: 2-(4-chlorophenyl)quinoline. InChIKey: GXFBUBKTTCNIRT-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)quinoline |
| InChIKey | GXFBUBKTTCNIRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)