cas: 482639-32-7 — see every product listed under this CAS number, including other names
2-Chloro-5,7-dimethylquinoline-3-carboxaldehyde (CAS 482639-32-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DGFB-250mg |
| cas | 482639-32-7 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 1226.00 Pln |
| delivery time | 3 weeks |
|---|
2-chloro-5,7-dimethylquinoline-3-carbaldehyde (CAS 482639-32-7) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 2-chloro-5,7-dimethylquinoline-3-carbaldehyde. InChIKey: DIMGKYRNZAHUIS-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 2-chloro-5,7-dimethylquinoline-3-carbaldehyde |
| InChIKey | DIMGKYRNZAHUIS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C(=NC2=C1)Cl)C=O)C |
Computed by PubChem (NCBI)