cas: 27794-03-2 — see every product listed under this CAS number, including other names
2-Chloro-5-(4-methoxyphenyl)pyrimidine (CAS 27794-03-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023557-1G |
| cas | 27794-03-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1664.02 Pln | |
| Fluorochem | 5g | 6880.93 Pln |
| delivery time | 1-2 weeks |
|---|
2-chloro-5-(4-methoxyphenyl)pyrimidine (CAS 27794-03-2) is a chemical compound with the molecular formula C11H9ClN2O and a molecular weight of 220.65 g/mol. IUPAC name: 2-chloro-5-(4-methoxyphenyl)pyrimidine. InChIKey: XASJMEVESBZEOO-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | 2-chloro-5-(4-methoxyphenyl)pyrimidine |
| InChIKey | XASJMEVESBZEOO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CN=C(N=C2)Cl |
Computed by PubChem (NCBI)