CAS 1174665-95-2 is the registry number for 1-Benzyl-1h-pyrazole-4-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-benzylpyrazole-4-carbonyl chloride (CAS 1174665-95-2) is a chemical compound with the molecular formula C11H9ClN2O and a molecular weight of 220.65 g/mol. IUPAC name: 1-benzylpyrazole-4-carbonyl chloride. InChIKey: KCSLMSWFSIEWJR-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O |
|---|---|
| Molecular weight | 220.65 g/mol |
| IUPAC name | 1-benzylpyrazole-4-carbonyl chloride |
| InChIKey | KCSLMSWFSIEWJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)C(=O)Cl |
Computed by PubChem (NCBI)