cas: 886360-70-9 — see every product listed under this CAS number, including other names
2-Chloro-5-(propan-2-yl)-1,3-thiazole-4-carboxylic acid, 97% (CAS 886360-70-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F655092-250MG |
| cas | 886360-70-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 500mg | 476.93 Pln | |
| Fluorochem | 1g | 581.06 Pln | |
| Fluorochem | 2.5g | 1122.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-5-propan-2-yl-1,3-thiazole-4-carboxylic acid (CAS 886360-70-9) is a chemical compound with the molecular formula C7H8ClNO2S and a molecular weight of 205.66 g/mol. IUPAC name: 2-chloro-5-propan-2-yl-1,3-thiazole-4-carboxylic acid. InChIKey: JBGWUKMKNIMSOU-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO2S |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | 2-chloro-5-propan-2-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | JBGWUKMKNIMSOU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N=C(S1)Cl)C(=O)O |
Computed by PubChem (NCBI)