cas: 886360-70-9 — see every product listed under this CAS number, including other names
2-Chloro-5-isopropylthiazole-4-carboxylic acid, 95% (CAS 886360-70-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A900489-10g |
| cas | 886360-70-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6833.89 Pln | |
| AmBeed | 5g | 3455.20 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-5-propan-2-yl-1,3-thiazole-4-carboxylic acid (CAS 886360-70-9) is a chemical compound with the molecular formula C7H8ClNO2S and a molecular weight of 205.66 g/mol. IUPAC name: 2-chloro-5-propan-2-yl-1,3-thiazole-4-carboxylic acid. InChIKey: JBGWUKMKNIMSOU-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO2S |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | 2-chloro-5-propan-2-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | JBGWUKMKNIMSOU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N=C(S1)Cl)C(=O)O |
Computed by PubChem (NCBI)