2-Chloro-5-(trifluoromethyl)aniline, 98%
cas: 121-50-6 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)aniline, 98% (CAS 121-50-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 25g, 100g, 500g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A643049-250mg |
| cas | 121-50-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 292.50 Pln | |
| Ambeed | 500g | 420.44 Pln | |
| Chemat | 250mg | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 150.80 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 25g | 269.93 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-5-(trifluoromethyl)aniline (CAS 121-50-6) is a chemical compound with the molecular formula C7H5ClF3N and a molecular weight of 195.57 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)aniline. InChIKey: VKTTYIXIDXWHKW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3N |
|---|---|
| Molecular weight | 195.57 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)aniline |
| InChIKey | VKTTYIXIDXWHKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)