cas: 72587-18-9 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)pyridin-3-amine 98% (CAS 72587-18-9) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111467-500g |
| cas | 72587-18-9 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 9854.44 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 314.75 Pln | |
| Ambeed | 25g | 681.88 Pln | |
| Ambeed | 100g | 2517.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A111467 |
2-chloro-5-(trifluoromethyl)pyridin-3-amine (CAS 72587-18-9) is a chemical compound with the molecular formula C6H4ClF3N2 and a molecular weight of 196.56 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)pyridin-3-amine. InChIKey: HABKYPVMMHBOIW-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2 |
|---|---|
| Molecular weight | 196.56 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)pyridin-3-amine |
| InChIKey | HABKYPVMMHBOIW-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)