2-Chloro-5-iodo-3-nitropyridine, 97%
cas: 426463-05-0 — see every product listed under this CAS number, including other names
2-Chloro-5-iodo-3-nitropyridine, 97% (CAS 426463-05-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A231642-250mg |
| cas | 426463-05-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 548.38 Pln | |
| Ambeed | 100g | 1660.88 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 292.14 Pln | |
| BLDpharm | 25g | 580.93 Pln | |
| BLDpharm | 100g | 1786.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-5-iodo-3-nitropyridine (CAS 426463-05-0) is a chemical compound with the molecular formula C5H2ClIN2O2 and a molecular weight of 284.44 g/mol. IUPAC name: 2-chloro-5-iodo-3-nitropyridine. InChIKey: PIJMRJPJERUFNI-UHFFFAOYSA-N.
| Molecular formula | C5H2ClIN2O2 |
|---|---|
| Molecular weight | 284.44 g/mol |
| IUPAC name | 2-chloro-5-iodo-3-nitropyridine |
| InChIKey | PIJMRJPJERUFNI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1[N+](=O)[O-])Cl)I |
Computed by PubChem (NCBI)