Products 2241239-40-5

CAS 2241239-40-5 is the registry number for 3-Chloro-6-iodopyridazine-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

3-chloro-6-iodopyridazine-4-carboxylic acid (CAS 2241239-40-5) is a chemical compound with the molecular formula C5H2ClIN2O2 and a molecular weight of 284.44 g/mol. IUPAC name: 3-chloro-6-iodopyridazine-4-carboxylic acid. InChIKey: XFGXSCWLPPVKNB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2ClIN2O2
Molecular weight284.44 g/mol
IUPAC name3-chloro-6-iodopyridazine-4-carboxylic acid
InChIKeyXFGXSCWLPPVKNB-UHFFFAOYSA-N
SMILESC1=C(C(=NN=C1I)Cl)C(=O)O

Computed by PubChem (NCBI)