cas: 2096336-34-2 — see every product listed under this CAS number, including other names
2-Chloro-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 97% (CAS 2096336-34-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A920531-250mg |
| cas | 2096336-34-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A920531 |
2-chloro-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2096336-34-2) is a chemical compound with the molecular formula C12H17BClNO3 and a molecular weight of 269.53 g/mol. IUPAC name: 2-chloro-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: GEOBECAAHNACLP-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO3 |
|---|---|
| Molecular weight | 269.53 g/mol |
| IUPAC name | 2-chloro-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | GEOBECAAHNACLP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2OC)Cl |
Computed by PubChem (NCBI)