Products 2121514-91-6
CAS 2121514-91-6 appears in our catalog under these names: 5-Chloro-2-methoxypyridine-4-boronic acid pinacol ester, 96%, 5-Chloro-2-methoxypyridine-4-boronic acid pinacol ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 5g.
5-chloro-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2121514-91-6) is a chemical compound with the molecular formula C12H17BClNO3 and a molecular weight of 269.53 g/mol. IUPAC name: 5-chloro-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: QSPAGXHWLPNPTN-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO3 |
|---|---|
| Molecular weight | 269.53 g/mol |
| IUPAC name | 5-chloro-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | QSPAGXHWLPNPTN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2Cl)OC |
Computed by PubChem (NCBI)