cas: 73568-31-7 — see every product listed under this CAS number, including other names
2-Chloro-6,8-dimethylquinoline-3-carbaldehyde, 95% (CAS 73568-31-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A140278-100mg |
| cas | 73568-31-7 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 493.15 Pln | |
| AmBeed | 5g | 5401.69 Pln | |
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1299.56 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-6,8-dimethylquinoline-3-carbaldehyde (CAS 73568-31-7) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 2-chloro-6,8-dimethylquinoline-3-carbaldehyde. InChIKey: FXUMJBPZONRYQS-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 2-chloro-6,8-dimethylquinoline-3-carbaldehyde |
| InChIKey | FXUMJBPZONRYQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C=C(C(=N2)Cl)C=O)C |
Computed by PubChem (NCBI)