cas: 1449475-29-9 — see every product listed under this CAS number, including other names
2-Chloro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 98%, 98% (CAS 1449475-29-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXCG-250mg |
| cas | 1449475-29-9 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2334.80 Pln | |
| Chemat | 100mg | 203.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1449475-29-9) is a chemical compound with the molecular formula C13H15BClNO2 and a molecular weight of 263.53 g/mol. IUPAC name: 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: MMAGXXNVDWQTPQ-UHFFFAOYSA-N.
| Molecular formula | C13H15BClNO2 |
|---|---|
| Molecular weight | 263.53 g/mol |
| IUPAC name | 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | MMAGXXNVDWQTPQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)C#N |
Computed by PubChem (NCBI)