CAS 863868-30-8 appears in our catalog under these names: 4–chloro–3–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)benzonitrile, 2-Chloro-5-cyanophenyl boronic acid pinacol ester, 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 97%, 97%, 2-Chloro-5-cyanophenyl boronic acid pinacol ester, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2,5g, 100mg, 250mg, 500mg.
4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 863868-30-8) is a chemical compound with the molecular formula C13H15BClNO2 and a molecular weight of 263.53 g/mol. IUPAC name: 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: DGMDRBZAUFPUJU-UHFFFAOYSA-N.
| Molecular formula | C13H15BClNO2 |
|---|---|
| Molecular weight | 263.53 g/mol |
| IUPAC name | 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | DGMDRBZAUFPUJU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C#N)Cl |
Computed by PubChem (NCBI)