cas: 56961-31-0 — see every product listed under this CAS number, including other names
2-Chloro-6-hydroxybenzoic acid 98% (CAS 56961-31-0) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A327508-500g |
| cas | 56961-31-0 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 15049.81 Pln | |
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 10g | 670.75 Pln | |
| Ambeed | 25g | 1249.25 Pln | |
| Ambeed | 100g | 3813.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A327508 |
2-chloro-6-hydroxybenzoic acid (CAS 56961-31-0) is a chemical compound with the molecular formula C7H5ClO3 and a molecular weight of 172.56 g/mol. IUPAC name: 2-chloro-6-hydroxybenzoic acid. InChIKey: QCEPIUWMXRQPIF-UHFFFAOYSA-N.
| Molecular formula | C7H5ClO3 |
|---|---|
| Molecular weight | 172.56 g/mol |
| IUPAC name | 2-chloro-6-hydroxybenzoic acid |
| InChIKey | QCEPIUWMXRQPIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)O)O |
Computed by PubChem (NCBI)