CAS 1829-32-9 appears in our catalog under these names: 3-Chlorosalicylic Acid, >95% (HPLC), 3–Chlorosalicylic acid, 3-Chlorosalicylic Acid, >98.0%(HPLC)(T), 3-Chloro-2-hydroxybenzoic acid 98%, 3-CHLOROSALICYLIC ACID, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 1g, 100g, 25g, 5g, 250mg, 500g.
3-chloro-2-hydroxybenzoic acid (CAS 1829-32-9) is a chemical compound with the molecular formula C7H5ClO3 and a molecular weight of 172.56 g/mol. IUPAC name: 3-chloro-2-hydroxybenzoic acid. InChIKey: PPINMMULCRBDOS-UHFFFAOYSA-N.
| Molecular formula | C7H5ClO3 |
|---|---|
| Molecular weight | 172.56 g/mol |
| IUPAC name | 3-chloro-2-hydroxybenzoic acid |
| InChIKey | PPINMMULCRBDOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)O)C(=O)O |
Computed by PubChem (NCBI)