2-Chloro-6-iodobenzoic acid, 97%
cas: 13420-63-8 — see every product listed under this CAS number, including other names
2-Chloro-6-iodobenzoic acid, 97% (CAS 13420-63-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A122391-250mg |
| cas | 13420-63-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 10g | 320.31 Pln | |
| Ambeed | 25g | 503.88 Pln | |
| Ambeed | 100g | 1549.62 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 242.16 Pln | |
| BLDpharm | 10g | 336.57 Pln | |
| BLDpharm | 25g | 536.50 Pln | |
| BLDpharm | 100g | 1669.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-6-iodobenzoic acid (CAS 13420-63-8) is a chemical compound with the molecular formula C7H4ClIO2 and a molecular weight of 282.46 g/mol. IUPAC name: 2-chloro-6-iodobenzoic acid. InChIKey: KNWHWEKCHWFXFZ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClIO2 |
|---|---|
| Molecular weight | 282.46 g/mol |
| IUPAC name | 2-chloro-6-iodobenzoic acid |
| InChIKey | KNWHWEKCHWFXFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)C(=O)O)Cl |
Computed by PubChem (NCBI)
