CAS 13420-63-8 appears in our catalog under these names: 2–Chloro–6–iodobenzoic acid, 2-Chloro-6-iodobenzoic acid, 2-Chloro-6-iodobenzoic acid 97%, 2-Chloro-6-iodobenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 2,5g, 0,25g, 250mg, 1g, 100g.
2-chloro-6-iodobenzoic acid (CAS 13420-63-8) is a chemical compound with the molecular formula C7H4ClIO2 and a molecular weight of 282.46 g/mol. IUPAC name: 2-chloro-6-iodobenzoic acid. InChIKey: KNWHWEKCHWFXFZ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClIO2 |
|---|---|
| Molecular weight | 282.46 g/mol |
| IUPAC name | 2-chloro-6-iodobenzoic acid |
| InChIKey | KNWHWEKCHWFXFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)C(=O)O)Cl |
Computed by PubChem (NCBI)