CAS 503000-87-1 appears in our catalog under these names: 2–Chloro–6–methoxynicotinic acid, 2-Chloro-6-methoxynicotinic acid, 2-Chloro-6-methoxynicotinic Acid, 95%, 95%, 2-Chloro-6-methoxynicotinic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g, 10g.
2-chloro-6-methoxypyridine-3-carboxylic acid (CAS 503000-87-1) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 2-chloro-6-methoxypyridine-3-carboxylic acid. InChIKey: JPBUYRWPJMVZKX-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 2-chloro-6-methoxypyridine-3-carboxylic acid |
| InChIKey | JPBUYRWPJMVZKX-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)