CAS 128073-09-6 appears in our catalog under these names: 3-Chloro-5-methoxypicolinic acid, 95%, 3–Chloro–5–methoxypicolinic acid, 3-Chloro-5-methoxypicolinic acid, 95%, 95%, 3-Chloro-5-methoxypicolinic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
3-chloro-5-methoxypyridine-2-carboxylic acid (CAS 128073-09-6) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 3-chloro-5-methoxypyridine-2-carboxylic acid. InChIKey: NYOBDBZFHLWEJL-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 3-chloro-5-methoxypyridine-2-carboxylic acid |
| InChIKey | NYOBDBZFHLWEJL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(N=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)