cas: 57729-79-0 — see every product listed under this CAS number, including other names
2-Chloro-6-nitro-4-(trifluoromethyl)aniline, 98%, 98% (CAS 57729-79-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KPB-100g |
| cas | 57729-79-0 |
| size | 100g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 1816.40 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 25g | 654.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-nitro-4-(trifluoromethyl)aniline (CAS 57729-79-0) is a chemical compound with the molecular formula C7H4ClF3N2O2 and a molecular weight of 240.57 g/mol. IUPAC name: 2-chloro-6-nitro-4-(trifluoromethyl)aniline. InChIKey: JLWRJMVXRUKFPA-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N2O2 |
|---|---|
| Molecular weight | 240.57 g/mol |
| IUPAC name | 2-chloro-6-nitro-4-(trifluoromethyl)aniline |
| InChIKey | JLWRJMVXRUKFPA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)