CAS 1688685-61-1 appears in our catalog under these names: Methyl 5-chloro-6-(trifluoromethyl)pyrazine-2-carboxylate, 95%, Methyl 5–chloro–6–(trifluoromethyl)pyrazine–2–carboxylate, Methyl 5-chloro-6-(trifluoromethyl)pyrazine-2-carboxylate 95%. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 100mg, 1g, 50mg.
Methyl 5-chloro-6-(trifluoromethyl)pyrazine-2-carboxylate (CAS 1688685-61-1) is a chemical compound with the molecular formula C7H4ClF3N2O2 and a molecular weight of 240.57 g/mol. IUPAC name: methyl 5-chloro-6-(trifluoromethyl)pyrazine-2-carboxylate. InChIKey: HIYPYTSNHTXCOD-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N2O2 |
|---|---|
| Molecular weight | 240.57 g/mol |
| IUPAC name | methyl 5-chloro-6-(trifluoromethyl)pyrazine-2-carboxylate |
| InChIKey | HIYPYTSNHTXCOD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C(=N1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)