cas: 154327-28-3 — see every product listed under this CAS number, including other names
2-Chloro-7-fluorobenzo[d]thiazole, 96% (CAS 154327-28-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F438335-100MG |
| cas | 154327-28-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1382.86 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-7-fluoro-1,3-benzothiazole (CAS 154327-28-3) is a chemical compound with the molecular formula C7H3ClFNS and a molecular weight of 187.62 g/mol. IUPAC name: 2-chloro-7-fluoro-1,3-benzothiazole. InChIKey: GQPCQNLKLWGDIX-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNS |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 2-chloro-7-fluoro-1,3-benzothiazole |
| InChIKey | GQPCQNLKLWGDIX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)SC(=N2)Cl |
Computed by PubChem (NCBI)