cas: 154327-28-3 — see every product listed under this CAS number, including other names
2-Chloro-7-fluorobenzo[d]thiazole, 98%, 98% (CAS 154327-28-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ANF6-100mg |
| cas | 154327-28-3 |
| size | 100mg |
| availability | 80g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 1283.60 Pln | |
| Chemat | 10g | 2138.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-7-fluoro-1,3-benzothiazole (CAS 154327-28-3) is a chemical compound with the molecular formula C7H3ClFNS and a molecular weight of 187.62 g/mol. IUPAC name: 2-chloro-7-fluoro-1,3-benzothiazole. InChIKey: GQPCQNLKLWGDIX-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNS |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 2-chloro-7-fluoro-1,3-benzothiazole |
| InChIKey | GQPCQNLKLWGDIX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)SC(=N2)Cl |
Computed by PubChem (NCBI)