cas: 128259-63-2 — see every product listed under this CAS number, including other names
2-Chloro-7-methoxyquinoline-3-carbonitrile 98% (CAS 128259-63-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A170938-250mg |
| cas | 128259-63-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1104.63 Pln | |
| Ambeed | 5g | 3980.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A170938 |
2-chloro-7-methoxyquinoline-3-carbonitrile (CAS 128259-63-2) is a chemical compound with the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. IUPAC name: 2-chloro-7-methoxyquinoline-3-carbonitrile. InChIKey: UTLRIOWIEJHVQJ-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 2-chloro-7-methoxyquinoline-3-carbonitrile |
| InChIKey | UTLRIOWIEJHVQJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC(=C(C=C2C=C1)C#N)Cl |
Computed by PubChem (NCBI)