CAS 13669-62-0 appears in our catalog under these names: 4-Chloro-6-methoxy-quinoline-3-carbonitrile, 97%, 4-Chloro-6-methoxy quinoline-3-carbonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 50mg.
4-chloro-6-methoxyquinoline-3-carbonitrile (CAS 13669-62-0) is a chemical compound with the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. IUPAC name: 4-chloro-6-methoxyquinoline-3-carbonitrile. InChIKey: VIKNILFXAQPQEF-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 4-chloro-6-methoxyquinoline-3-carbonitrile |
| InChIKey | VIKNILFXAQPQEF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=CN=C2C=C1)C#N)Cl |
Computed by PubChem (NCBI)