cas: 920494-31-1 — see every product listed under this CAS number, including other names
2-Chloro-8-(trifluoromethyl)quinoline, 98%, 98% (CAS 920494-31-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1172IF-100mg |
| cas | 920494-31-1 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 827.60 Pln | |
| Chemat | 1g | 2008.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-8-(trifluoromethyl)quinoline (CAS 920494-31-1) is a chemical compound with the molecular formula C10H5ClF3N and a molecular weight of 231.60 g/mol. IUPAC name: 2-chloro-8-(trifluoromethyl)quinoline. InChIKey: GQTIMPLUHKAFLZ-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF3N |
|---|---|
| Molecular weight | 231.60 g/mol |
| IUPAC name | 2-chloro-8-(trifluoromethyl)quinoline |
| InChIKey | GQTIMPLUHKAFLZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(F)(F)F)N=C(C=C2)Cl |
Computed by PubChem (NCBI)