CAS 1065074-68-1 is the registry number for 6-Chloro-8-(trifluoromethyl)quinoline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
6-chloro-8-(trifluoromethyl)quinoline (CAS 1065074-68-1) is a chemical compound with the molecular formula C10H5ClF3N and a molecular weight of 231.60 g/mol. IUPAC name: 6-chloro-8-(trifluoromethyl)quinoline. InChIKey: OZRDWVIFEHZWCL-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF3N |
|---|---|
| Molecular weight | 231.60 g/mol |
| IUPAC name | 6-chloro-8-(trifluoromethyl)quinoline |
| InChIKey | OZRDWVIFEHZWCL-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)