cas: 857653-85-1 — see every product listed under this CAS number, including other names
2-Chloro-N'-hydroxyisonicotinimidamide 96% (CAS 857653-85-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175643-250mg |
| cas | 857653-85-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1666.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A175643 |
2-chloro-N'-hydroxypyridine-4-carboximidamide (CAS 857653-85-1) is a chemical compound with the molecular formula C6H6ClN3O and a molecular weight of 171.58 g/mol. IUPAC name: 2-chloro-N'-hydroxypyridine-4-carboximidamide. InChIKey: FUSMRNWUUNGSEH-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 2-chloro-N'-hydroxypyridine-4-carboximidamide |
| InChIKey | FUSMRNWUUNGSEH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1/C(=N/O)/N)Cl |
Computed by PubChem (NCBI)