cas: 39106-10-0 — see every product listed under this CAS number, including other names
2-Chloro-N-(2,4-dimethyl-phenyl)-acetamide, 98% (CAS 39106-10-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F057506-250MG |
| cas | 39106-10-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 1g | 565.44 Pln | |
| Fluorochem | 5g | 1351.63 Pln | |
| Fluorochem | 10g | 2637.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-N-(2,4-dimethylphenyl)acetamide (CAS 39106-10-0) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 2-chloro-N-(2,4-dimethylphenyl)acetamide. InChIKey: MZTGUDQVUJJYCK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 2-chloro-N-(2,4-dimethylphenyl)acetamide |
| InChIKey | MZTGUDQVUJJYCK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)CCl)C |
Computed by PubChem (NCBI)